C12H19NO2S — CID 114991336
2-ethyl-2-[methyl(thiophen-3-ylmethyl)amino]butanoic acid (PubChem CID 114991336) has the molecular formula C12H19NO2S and a molecular weight of 241.36 g/mol. Its IUPAC name is 2-ethyl-2-[methyl(thiophen-3-ylmethyl)amino]butanoic acid.
| Compound Name | 2-ethyl-2-[methyl(thiophen-3-ylmethyl)amino]butanoic acid |
|---|---|
| PubChem CID | 114991336 |
| Molecular Formula | C12H19NO2S |
| Molecular Weight | 241.36 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | 2-ethyl-2-[methyl(thiophen-3-ylmethyl)amino]butanoic acid |
| SMILES | CCC(CC)(C(=O)O)N(C)Cc1ccsc1 |
| InChI | InChI=1S/C12H19NO2S/c1-4-12(5-2,11(14)15)13(3)8-10-6-7-16-9-10/h6-7,9H,4-5,8H2,1-3H3,(H,14,15) |
| InChIKey | LBHVFJBPKSDKNZ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |