C11H17IN2 — CID 154733830
N'-ethyl-N'-[(3-iodophenyl)methyl]ethane-1,2-diamine (PubChem CID 154733830) has the molecular formula C11H17IN2 and a molecular weight of 304.17 g/mol. Its IUPAC name is N'-ethyl-N'-[(3-iodophenyl)methyl]ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-[(3-iodophenyl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 154733830 |
| Molecular Formula | C11H17IN2 |
| Molecular Weight | 304.17 g/mol |
| Exact Mass | 304.04 |
| IUPAC Name | N'-ethyl-N'-[(3-iodophenyl)methyl]ethane-1,2-diamine |
| SMILES | CCN(CCN)Cc1cccc(I)c1 |
| InChI | InChI=1S/C11H17IN2/c1-2-14(7-6-13)9-10-4-3-5-11(12)8-10/h3-5,8H,2,6-7,9,13H2,1H3 |
| InChIKey | OXUMAWYZJKJPNB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.17 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|