C9H15IN2S — CID 103102067
N'-ethyl-N'-[(5-iodothiophen-3-yl)methyl]ethane-1,2-diamine (PubChem CID 103102067) has the molecular formula C9H15IN2S and a molecular weight of 310.20 g/mol. Its IUPAC name is N'-ethyl-N'-[(5-iodothiophen-3-yl)methyl]ethane-1,2-diamine.
| Compound Name | N'-ethyl-N'-[(5-iodothiophen-3-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 103102067 |
| Molecular Formula | C9H15IN2S |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 310.00 |
| IUPAC Name | N'-ethyl-N'-[(5-iodothiophen-3-yl)methyl]ethane-1,2-diamine |
| SMILES | CCN(CCN)Cc1csc(I)c1 |
| InChI | InChI=1S/C9H15IN2S/c1-2-12(4-3-11)6-8-5-9(10)13-7-8/h5,7H,2-4,6,11H2,1H3 |
| InChIKey | UZEDALIXAGYQEK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|