C12H19FN2 — CID 61350683
N'-[(3-fluorophenyl)methyl]-N'-propylethane-1,2-diamine (PubChem CID 61350683) has the molecular formula C12H19FN2 and a molecular weight of 210.30 g/mol. Its IUPAC name is N'-[(3-fluorophenyl)methyl]-N'-propylethane-1,2-diamine.
| Compound Name | N'-[(3-fluorophenyl)methyl]-N'-propylethane-1,2-diamine |
|---|---|
| PubChem CID | 61350683 |
| Molecular Formula | C12H19FN2 |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | N'-[(3-fluorophenyl)methyl]-N'-propylethane-1,2-diamine |
| SMILES | CCCN(CCN)Cc1cccc(F)c1 |
| InChI | InChI=1S/C12H19FN2/c1-2-7-15(8-6-14)10-11-4-3-5-12(13)9-11/h3-5,9H,2,6-8,10,14H2,1H3 |
| InChIKey | CXOGRVJIGFCYCC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |