C13H19F2N — CID 78821646
N-[(3,4-difluorophenyl)methyl]-N-propylpropan-1-amine (PubChem CID 78821646) has the molecular formula C13H19F2N and a molecular weight of 227.30 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-N-propylpropan-1-amine.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 78821646 |
| Molecular Formula | C13H19F2N |
| Molecular Weight | 227.30 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-N-propylpropan-1-amine |
| SMILES | CCCN(CCC)Cc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C13H19F2N/c1-3-7-16(8-4-2)10-11-5-6-12(14)13(15)9-11/h5-6,9H,3-4,7-8,10H2,1-2H3 |
| InChIKey | ZCUMAQUZXLSNLE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.30 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |