C11H18F2 — CID 160697343
1,2-difluoro-4-propylbenzene;methane (PubChem CID 160697343) has the molecular formula C11H18F2 and a molecular weight of 188.26 g/mol. Its IUPAC name is 1,2-difluoro-4-propylbenzene;methane.
| Compound Name | 1,2-difluoro-4-propylbenzene;methane |
|---|---|
| PubChem CID | 160697343 |
| Molecular Formula | C11H18F2 |
| Molecular Weight | 188.26 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | 1,2-difluoro-4-propylbenzene;methane |
| SMILES | C.C.CCCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C9H10F2.2CH4/c1-2-3-7-4-5-8(10)9(11)6-7;;/h4-6H,2-3H2,1H3;2*1H4 |
| InChIKey | RQDYAUHJGMILAH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.26 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |