C11H10F2 — CID 83936202
1,2-difluoro-4-pent-3-ynylbenzene (PubChem CID 83936202) has the molecular formula C11H10F2 and a molecular weight of 180.20 g/mol. Its IUPAC name is 1,2-difluoro-4-pent-3-ynylbenzene.
| Compound Name | 1,2-difluoro-4-pent-3-ynylbenzene |
|---|---|
| PubChem CID | 83936202 |
| Molecular Formula | C11H10F2 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 1,2-difluoro-4-pent-3-ynylbenzene |
| SMILES | CC#CCCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H10F2/c1-2-3-4-5-9-6-7-10(12)11(13)8-9/h6-8H,4-5H2,1H3 |
| InChIKey | NELKRSDLEODXFB-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|