C11H11F2N — CID 62311938
N-[(3,4-difluorophenyl)methyl]but-2-yn-1-amine (PubChem CID 62311938) has the molecular formula C11H11F2N and a molecular weight of 195.21 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]but-2-yn-1-amine.
| Compound Name | N-[(3,4-difluorophenyl)methyl]but-2-yn-1-amine |
|---|---|
| PubChem CID | 62311938 |
| Molecular Formula | C11H11F2N |
| Molecular Weight | 195.21 g/mol |
| Exact Mass | 195.09 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]but-2-yn-1-amine |
| SMILES | CC#CCNCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H11F2N/c1-2-3-6-14-8-9-4-5-10(12)11(13)7-9/h4-5,7,14H,6,8H2,1H3 |
| InChIKey | JATARTRXVHWCNA-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.21 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|