C13H13FN2 — CID 107880493
2-fluoro-5-[(pent-3-ynylamino)methyl]benzonitrile (PubChem CID 107880493) has the molecular formula C13H13FN2 and a molecular weight of 216.26 g/mol. Its IUPAC name is 2-fluoro-5-[(pent-3-ynylamino)methyl]benzonitrile.
| Compound Name | 2-fluoro-5-[(pent-3-ynylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 107880493 |
| Molecular Formula | C13H13FN2 |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.11 |
| IUPAC Name | 2-fluoro-5-[(pent-3-ynylamino)methyl]benzonitrile |
| SMILES | CC#CCCNCc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C13H13FN2/c1-2-3-4-7-16-10-11-5-6-13(14)12(8-11)9-15/h5-6,8,16H,4,7,10H2,1H3 |
| InChIKey | PZZKWFRAHFRDMC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|