C13H17FN2S — CID 114012155
2-fluoro-5-[(4-methylsulfanylbutylamino)methyl]benzonitrile (PubChem CID 114012155) has the molecular formula C13H17FN2S and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-fluoro-5-[(4-methylsulfanylbutylamino)methyl]benzonitrile.
| Compound Name | 2-fluoro-5-[(4-methylsulfanylbutylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 114012155 |
| Molecular Formula | C13H17FN2S |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | 2-fluoro-5-[(4-methylsulfanylbutylamino)methyl]benzonitrile |
| SMILES | CSCCCCNCc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C13H17FN2S/c1-17-7-3-2-6-16-10-11-4-5-13(14)12(8-11)9-15/h4-5,8,16H,2-3,6-7,10H2,1H3 |
| InChIKey | NGXQHFYFMWLUPR-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|