C12H15FN2S — CID 107880243
2-fluoro-5-[(3-methylsulfanylpropylamino)methyl]benzonitrile (PubChem CID 107880243) has the molecular formula C12H15FN2S and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-fluoro-5-[(3-methylsulfanylpropylamino)methyl]benzonitrile.
| Compound Name | 2-fluoro-5-[(3-methylsulfanylpropylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 107880243 |
| Molecular Formula | C12H15FN2S |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.09 |
| IUPAC Name | 2-fluoro-5-[(3-methylsulfanylpropylamino)methyl]benzonitrile |
| SMILES | CSCCCNCc1ccc(F)c(C#N)c1 |
| InChI | InChI=1S/C12H15FN2S/c1-16-6-2-5-15-9-10-3-4-12(13)11(7-10)8-14/h3-4,7,15H,2,5-6,9H2,1H3 |
| InChIKey | PYQHZURVQWJJDH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|