C11H11Br2N — CID 130617331
N-[(3,5-dibromophenyl)methyl]but-2-yn-1-amine (PubChem CID 130617331) has the molecular formula C11H11Br2N and a molecular weight of 317.02 g/mol. Its IUPAC name is N-[(3,5-dibromophenyl)methyl]but-2-yn-1-amine.
| Compound Name | N-[(3,5-dibromophenyl)methyl]but-2-yn-1-amine |
|---|---|
| PubChem CID | 130617331 |
| Molecular Formula | C11H11Br2N |
| Molecular Weight | 317.02 g/mol |
| Exact Mass | 314.93 |
| IUPAC Name | N-[(3,5-dibromophenyl)methyl]but-2-yn-1-amine |
| SMILES | CC#CCNCc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C11H11Br2N/c1-2-3-4-14-8-9-5-10(12)7-11(13)6-9/h5-7,14H,4,8H2,1H3 |
| InChIKey | FDXCPRSUGMEYKB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.02 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|