C27H30F6N4 — CID 59750973
N-[(3,4-difluorophenyl)methyl]-N',N'-bis[2-[(3,4-difluorophenyl)methylamino]ethyl]ethane-1,2-diamine (PubChem CID 59750973) has the molecular formula C27H30F6N4 and a molecular weight of 524.55 g/mol. Its IUPAC name is N-[(3,4-difluorophenyl)methyl]-N',N'-bis[2-[(3,4-difluorophenyl)methylamino]ethyl]ethane-1,2-diamine.
| Compound Name | N-[(3,4-difluorophenyl)methyl]-N',N'-bis[2-[(3,4-difluorophenyl)methylamino]ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 59750973 |
| Molecular Formula | C27H30F6N4 |
| Molecular Weight | 524.55 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | N-[(3,4-difluorophenyl)methyl]-N',N'-bis[2-[(3,4-difluorophenyl)methylamino]ethyl]ethane-1,2-diamine |
| SMILES | Fc1ccc(CNCCN(CCNCc2ccc(F)c(F)c2)CCNCc2ccc(F)c(F)c2)cc1F |
| InChI | InChI=1S/C27H30F6N4/c28-22-4-1-19(13-25(22)31)16-34-7-10-37(11-8-35-17-20-2-5-23(29)26(32)14-20)12-9-36-18-21-3-6-24(30)27(33)15-21/h1-6,13-15,34-36H,7-12,16-18H2 |
| InChIKey | BHBZPAHFCOEEDQ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 39.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.55 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|