C10H14F2N2O2S — CID 28731622
N-[2-[(3,4-difluorophenyl)methylamino]ethyl]methanesulfonamide (PubChem CID 28731622) has the molecular formula C10H14F2N2O2S and a molecular weight of 264.30 g/mol. Its IUPAC name is N-[2-[(3,4-difluorophenyl)methylamino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(3,4-difluorophenyl)methylamino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 28731622 |
| Molecular Formula | C10H14F2N2O2S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N-[2-[(3,4-difluorophenyl)methylamino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNCc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H14F2N2O2S/c1-17(15,16)14-5-4-13-7-8-2-3-9(11)10(12)6-8/h2-3,6,13-14H,4-5,7H2,1H3 |
| InChIKey | OXGRZSPVPNFEDG-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|