C16H18F2N2O3S — CID 49463594
N-[2-[[4-(3,5-difluorophenoxy)phenyl]methylamino]ethyl]methanesulfonamide (PubChem CID 49463594) has the molecular formula C16H18F2N2O3S and a molecular weight of 356.39 g/mol. Its IUPAC name is N-[2-[[4-(3,5-difluorophenoxy)phenyl]methylamino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[4-(3,5-difluorophenoxy)phenyl]methylamino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 49463594 |
| Molecular Formula | C16H18F2N2O3S |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | N-[2-[[4-(3,5-difluorophenoxy)phenyl]methylamino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNCc1ccc(Oc2cc(F)cc(F)c2)cc1 |
| InChI | InChI=1S/C16H18F2N2O3S/c1-24(21,22)20-7-6-19-11-12-2-4-15(5-3-12)23-16-9-13(17)8-14(18)10-16/h2-5,8-10,19-20H,6-7,11H2,1H3 |
| InChIKey | NHLASSQRWZSQRA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|