C10H14F2N2O3S — CID 79831323
N-[2-[(3,5-difluoro-4-hydroxyphenyl)methylamino]ethyl]methanesulfonamide (PubChem CID 79831323) has the molecular formula C10H14F2N2O3S and a molecular weight of 280.30 g/mol. Its IUPAC name is N-[2-[(3,5-difluoro-4-hydroxyphenyl)methylamino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(3,5-difluoro-4-hydroxyphenyl)methylamino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 79831323 |
| Molecular Formula | C10H14F2N2O3S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | N-[2-[(3,5-difluoro-4-hydroxyphenyl)methylamino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNCc1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C10H14F2N2O3S/c1-18(16,17)14-3-2-13-6-7-4-8(11)10(15)9(12)5-7/h4-5,13-15H,2-3,6H2,1H3 |
| InChIKey | XEQPPUGZKXOQAH-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|