C11H14F2N2O2 — CID 79891294
4-[(3,5-difluoro-4-hydroxyphenyl)methylamino]butanamide (PubChem CID 79891294) has the molecular formula C11H14F2N2O2 and a molecular weight of 244.24 g/mol. Its IUPAC name is 4-[(3,5-difluoro-4-hydroxyphenyl)methylamino]butanamide.
| Compound Name | 4-[(3,5-difluoro-4-hydroxyphenyl)methylamino]butanamide |
|---|---|
| PubChem CID | 79891294 |
| Molecular Formula | C11H14F2N2O2 |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.10 |
| IUPAC Name | 4-[(3,5-difluoro-4-hydroxyphenyl)methylamino]butanamide |
| SMILES | NC(=O)CCCNCc1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C11H14F2N2O2/c12-8-4-7(5-9(13)11(8)17)6-15-3-1-2-10(14)16/h4-5,15,17H,1-3,6H2,(H2,14,16) |
| InChIKey | ZSRGWESQXXKZGS-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|