C14H21F2NO2 — CID 115680041
4-[(3-butoxypropylamino)methyl]-2,6-difluorophenol (PubChem CID 115680041) has the molecular formula C14H21F2NO2 and a molecular weight of 273.32 g/mol. Its IUPAC name is 4-[(3-butoxypropylamino)methyl]-2,6-difluorophenol.
| Compound Name | 4-[(3-butoxypropylamino)methyl]-2,6-difluorophenol |
|---|---|
| PubChem CID | 115680041 |
| Molecular Formula | C14H21F2NO2 |
| Molecular Weight | 273.32 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 4-[(3-butoxypropylamino)methyl]-2,6-difluorophenol |
| SMILES | CCCCOCCCNCc1cc(F)c(O)c(F)c1 |
| InChI | InChI=1S/C14H21F2NO2/c1-2-3-6-19-7-4-5-17-10-11-8-12(15)14(18)13(16)9-11/h8-9,17-18H,2-7,10H2,1H3 |
| InChIKey | JXGZIZWNMFLASC-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|