C15H17F2NO3 — CID 79832671
2,6-difluoro-4-[[3-(furan-2-ylmethoxy)propylamino]methyl]phenol (PubChem CID 79832671) has the molecular formula C15H17F2NO3 and a molecular weight of 297.30 g/mol. Its IUPAC name is 2,6-difluoro-4-[[3-(furan-2-ylmethoxy)propylamino]methyl]phenol.
| Compound Name | 2,6-difluoro-4-[[3-(furan-2-ylmethoxy)propylamino]methyl]phenol |
|---|---|
| PubChem CID | 79832671 |
| Molecular Formula | C15H17F2NO3 |
| Molecular Weight | 297.30 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | 2,6-difluoro-4-[[3-(furan-2-ylmethoxy)propylamino]methyl]phenol |
| SMILES | Oc1c(F)cc(CNCCCOCc2ccco2)cc1F |
| InChI | InChI=1S/C15H17F2NO3/c16-13-7-11(8-14(17)15(13)19)9-18-4-2-5-20-10-12-3-1-6-21-12/h1,3,6-8,18-19H,2,4-5,9-10H2 |
| InChIKey | WJYZMFWOMZHKQR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 54.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.30 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|