C14H18N2O2 — CID 28681171
3-(furan-2-ylmethoxy)-N-(pyridin-3-ylmethyl)propan-1-amine (PubChem CID 28681171) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-(furan-2-ylmethoxy)-N-(pyridin-3-ylmethyl)propan-1-amine.
| Compound Name | 3-(furan-2-ylmethoxy)-N-(pyridin-3-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 28681171 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 3-(furan-2-ylmethoxy)-N-(pyridin-3-ylmethyl)propan-1-amine |
| SMILES | c1cncc(CNCCCOCc2ccco2)c1 |
| InChI | InChI=1S/C14H18N2O2/c1-4-13(10-15-6-1)11-16-7-3-8-17-12-14-5-2-9-18-14/h1-2,4-6,9-10,16H,3,7-8,11-12H2 |
| InChIKey | XBOVSNNIYLDUEO-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|