C12H18N4O2 — CID 115682204
3-(furan-2-ylmethoxy)-N-[(3-methyltriazol-4-yl)methyl]propan-1-amine (PubChem CID 115682204) has the molecular formula C12H18N4O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is 3-(furan-2-ylmethoxy)-N-[(3-methyltriazol-4-yl)methyl]propan-1-amine.
| Compound Name | 3-(furan-2-ylmethoxy)-N-[(3-methyltriazol-4-yl)methyl]propan-1-amine |
|---|---|
| PubChem CID | 115682204 |
| Molecular Formula | C12H18N4O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.14 |
| IUPAC Name | 3-(furan-2-ylmethoxy)-N-[(3-methyltriazol-4-yl)methyl]propan-1-amine |
| SMILES | Cn1nncc1CNCCCOCc1ccco1 |
| InChI | InChI=1S/C12H18N4O2/c1-16-11(9-14-15-16)8-13-5-3-6-17-10-12-4-2-7-18-12/h2,4,7,9,13H,3,5-6,8,10H2,1H3 |
| InChIKey | TTWLDELGRAECLI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 65.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|