C11H16F2N2O3S — CID 54938960
N-[2-[[2-(3,4-difluorophenyl)-2-hydroxyethyl]amino]ethyl]methanesulfonamide (PubChem CID 54938960) has the molecular formula C11H16F2N2O3S and a molecular weight of 294.32 g/mol. Its IUPAC name is N-[2-[[2-(3,4-difluorophenyl)-2-hydroxyethyl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[2-(3,4-difluorophenyl)-2-hydroxyethyl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 54938960 |
| Molecular Formula | C11H16F2N2O3S |
| Molecular Weight | 294.32 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | N-[2-[[2-(3,4-difluorophenyl)-2-hydroxyethyl]amino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNCC(O)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H16F2N2O3S/c1-19(17,18)15-5-4-14-7-11(16)8-2-3-9(12)10(13)6-8/h2-3,6,11,14-16H,4-5,7H2,1H3 |
| InChIKey | QEMXMZFSEQWHCR-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.32 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|