C11H14FN3O2S — CID 43546043
N-[2-[(5-cyano-2-fluorophenyl)methylamino]ethyl]methanesulfonamide (PubChem CID 43546043) has the molecular formula C11H14FN3O2S and a molecular weight of 271.32 g/mol. Its IUPAC name is N-[2-[(5-cyano-2-fluorophenyl)methylamino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[(5-cyano-2-fluorophenyl)methylamino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 43546043 |
| Molecular Formula | C11H14FN3O2S |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | N-[2-[(5-cyano-2-fluorophenyl)methylamino]ethyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NCCNCc1cc(C#N)ccc1F |
| InChI | InChI=1S/C11H14FN3O2S/c1-18(16,17)15-5-4-14-8-10-6-9(7-13)2-3-11(10)12/h2-3,6,14-15H,4-5,8H2,1H3 |
| InChIKey | OXGPAVKNOVVQHW-UHFFFAOYSA-N |
| XLogP | 0.34 |
| TPSA | 81.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|