C12H12F4N2 — CID 115518185
4-fluoro-3-[(4,4,4-trifluorobutylamino)methyl]benzonitrile (PubChem CID 115518185) has the molecular formula C12H12F4N2 and a molecular weight of 260.23 g/mol. Its IUPAC name is 4-fluoro-3-[(4,4,4-trifluorobutylamino)methyl]benzonitrile.
| Compound Name | 4-fluoro-3-[(4,4,4-trifluorobutylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 115518185 |
| Molecular Formula | C12H12F4N2 |
| Molecular Weight | 260.23 g/mol |
| Exact Mass | 260.09 |
| IUPAC Name | 4-fluoro-3-[(4,4,4-trifluorobutylamino)methyl]benzonitrile |
| SMILES | N#Cc1ccc(F)c(CNCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H12F4N2/c13-11-3-2-9(7-17)6-10(11)8-18-5-1-4-12(14,15)16/h2-3,6,18H,1,4-5,8H2 |
| InChIKey | BWGZCSYFLLKUAQ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|