C12H13F3N2 — CID 79039914
3-[(4,4,4-trifluorobutylamino)methyl]benzonitrile (PubChem CID 79039914) has the molecular formula C12H13F3N2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 3-[(4,4,4-trifluorobutylamino)methyl]benzonitrile.
| Compound Name | 3-[(4,4,4-trifluorobutylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 79039914 |
| Molecular Formula | C12H13F3N2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 3-[(4,4,4-trifluorobutylamino)methyl]benzonitrile |
| SMILES | N#Cc1cccc(CNCCCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H13F3N2/c13-12(14,15)5-2-6-17-9-11-4-1-3-10(7-11)8-16/h1,3-4,7,17H,2,5-6,9H2 |
| InChIKey | FQTFENHXSARAIT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|