C13H15F3N2 — CID 114480624
3-methyl-4-[(4,4,4-trifluorobutylamino)methyl]benzonitrile (PubChem CID 114480624) has the molecular formula C13H15F3N2 and a molecular weight of 256.27 g/mol. Its IUPAC name is 3-methyl-4-[(4,4,4-trifluorobutylamino)methyl]benzonitrile.
| Compound Name | 3-methyl-4-[(4,4,4-trifluorobutylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 114480624 |
| Molecular Formula | C13H15F3N2 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | 3-methyl-4-[(4,4,4-trifluorobutylamino)methyl]benzonitrile |
| SMILES | Cc1cc(C#N)ccc1CNCCCC(F)(F)F |
| InChI | InChI=1S/C13H15F3N2/c1-10-7-11(8-17)3-4-12(10)9-18-6-2-5-13(14,15)16/h3-4,7,18H,2,5-6,9H2,1H3 |
| InChIKey | QTTBLSKUDNUIAE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|