C11H15N3 — CID 114480201
4-[(2-aminoethylamino)methyl]-3-methylbenzonitrile (PubChem CID 114480201) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 4-[(2-aminoethylamino)methyl]-3-methylbenzonitrile.
| Compound Name | 4-[(2-aminoethylamino)methyl]-3-methylbenzonitrile |
|---|---|
| PubChem CID | 114480201 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 4-[(2-aminoethylamino)methyl]-3-methylbenzonitrile |
| SMILES | Cc1cc(C#N)ccc1CNCCN |
| InChI | InChI=1S/C11H15N3/c1-9-6-10(7-13)2-3-11(9)8-14-5-4-12/h2-3,6,14H,4-5,8,12H2,1H3 |
| InChIKey | RXWUYNWOKOESSV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|