C14H16N2 — CID 114480868
3-methyl-4-[(pent-3-ynylamino)methyl]benzonitrile (PubChem CID 114480868) has the molecular formula C14H16N2 and a molecular weight of 212.30 g/mol. Its IUPAC name is 3-methyl-4-[(pent-3-ynylamino)methyl]benzonitrile.
| Compound Name | 3-methyl-4-[(pent-3-ynylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 114480868 |
| Molecular Formula | C14H16N2 |
| Molecular Weight | 212.30 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | 3-methyl-4-[(pent-3-ynylamino)methyl]benzonitrile |
| SMILES | CC#CCCNCc1ccc(C#N)cc1C |
| InChI | InChI=1S/C14H16N2/c1-3-4-5-8-16-11-14-7-6-13(10-15)9-12(14)2/h6-7,9,16H,5,8,11H2,1-2H3 |
| InChIKey | BNAYQNSNGDAVOI-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|