C14H18N2S — CID 106427385
3-methyl-4-[(2-prop-2-enylsulfanylethylamino)methyl]benzonitrile (PubChem CID 106427385) has the molecular formula C14H18N2S and a molecular weight of 246.38 g/mol. Its IUPAC name is 3-methyl-4-[(2-prop-2-enylsulfanylethylamino)methyl]benzonitrile.
| Compound Name | 3-methyl-4-[(2-prop-2-enylsulfanylethylamino)methyl]benzonitrile |
|---|---|
| PubChem CID | 106427385 |
| Molecular Formula | C14H18N2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.12 |
| IUPAC Name | 3-methyl-4-[(2-prop-2-enylsulfanylethylamino)methyl]benzonitrile |
| SMILES | C=CCSCCNCc1ccc(C#N)cc1C |
| InChI | InChI=1S/C14H18N2S/c1-3-7-17-8-6-16-11-14-5-4-13(10-15)9-12(14)2/h3-5,9,16H,1,6-8,11H2,2H3 |
| InChIKey | ORIILXDUZGODSE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|