C14H21NS — CID 103647860
N-[(2,4-dimethylphenyl)methyl]-2-prop-2-enylsulfanylethanamine (PubChem CID 103647860) has the molecular formula C14H21NS and a molecular weight of 235.40 g/mol. Its IUPAC name is N-[(2,4-dimethylphenyl)methyl]-2-prop-2-enylsulfanylethanamine.
| Compound Name | N-[(2,4-dimethylphenyl)methyl]-2-prop-2-enylsulfanylethanamine |
|---|---|
| PubChem CID | 103647860 |
| Molecular Formula | C14H21NS |
| Molecular Weight | 235.40 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | N-[(2,4-dimethylphenyl)methyl]-2-prop-2-enylsulfanylethanamine |
| SMILES | C=CCSCCNCc1ccc(C)cc1C |
| InChI | InChI=1S/C14H21NS/c1-4-8-16-9-7-15-11-14-6-5-12(2)10-13(14)3/h4-6,10,15H,1,7-9,11H2,2-3H3 |
| InChIKey | VXTOFRYXBILSSK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|