C14H22ClNS — CID 115615243
N-[(2,3-dimethylphenyl)methyl]-2-prop-2-enylsulfanylethanamine;hydrochloride (PubChem CID 115615243) has the molecular formula C14H22ClNS and a molecular weight of 271.86 g/mol. Its IUPAC name is N-[(2,3-dimethylphenyl)methyl]-2-prop-2-enylsulfanylethanamine;hydrochloride.
| Compound Name | N-[(2,3-dimethylphenyl)methyl]-2-prop-2-enylsulfanylethanamine;hydrochloride |
|---|---|
| PubChem CID | 115615243 |
| Molecular Formula | C14H22ClNS |
| Molecular Weight | 271.86 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | N-[(2,3-dimethylphenyl)methyl]-2-prop-2-enylsulfanylethanamine;hydrochloride |
| SMILES | C=CCSCCNCc1cccc(C)c1C.Cl |
| InChI | InChI=1S/C14H21NS.ClH/c1-4-9-16-10-8-15-11-14-7-5-6-12(2)13(14)3;/h4-7,15H,1,8-11H2,2-3H3;1H |
| InChIKey | QLVMQNJQQXOWAM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.86 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|