C10H12FN3 — CID 62140338
4-[(2-aminoethylamino)methyl]-3-fluorobenzonitrile (PubChem CID 62140338) has the molecular formula C10H12FN3 and a molecular weight of 193.23 g/mol. Its IUPAC name is 4-[(2-aminoethylamino)methyl]-3-fluorobenzonitrile.
| Compound Name | 4-[(2-aminoethylamino)methyl]-3-fluorobenzonitrile |
|---|---|
| PubChem CID | 62140338 |
| Molecular Formula | C10H12FN3 |
| Molecular Weight | 193.23 g/mol |
| Exact Mass | 193.10 |
| IUPAC Name | 4-[(2-aminoethylamino)methyl]-3-fluorobenzonitrile |
| SMILES | N#Cc1ccc(CNCCN)c(F)c1 |
| InChI | InChI=1S/C10H12FN3/c11-10-5-8(6-13)1-2-9(10)7-14-4-3-12/h1-2,5,14H,3-4,7,12H2 |
| InChIKey | MSGFDGBGWNLINS-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|