C13H15FN2S — CID 107267339
3-fluoro-4-[[(1-methylsulfanylcyclopropyl)methylamino]methyl]benzonitrile (PubChem CID 107267339) has the molecular formula C13H15FN2S and a molecular weight of 250.34 g/mol. Its IUPAC name is 3-fluoro-4-[[(1-methylsulfanylcyclopropyl)methylamino]methyl]benzonitrile.
| Compound Name | 3-fluoro-4-[[(1-methylsulfanylcyclopropyl)methylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 107267339 |
| Molecular Formula | C13H15FN2S |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 3-fluoro-4-[[(1-methylsulfanylcyclopropyl)methylamino]methyl]benzonitrile |
| SMILES | CSC1(CNCc2ccc(C#N)cc2F)CC1 |
| InChI | InChI=1S/C13H15FN2S/c1-17-13(4-5-13)9-16-8-11-3-2-10(7-15)6-12(11)14/h2-3,6,16H,4-5,8-9H2,1H3 |
| InChIKey | LWHBDSJSRLUSEM-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |