C11H10F4N2S — CID 113278166
3-fluoro-4-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]benzonitrile (PubChem CID 113278166) has the molecular formula C11H10F4N2S and a molecular weight of 278.27 g/mol. Its IUPAC name is 3-fluoro-4-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]benzonitrile.
| Compound Name | 3-fluoro-4-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 113278166 |
| Molecular Formula | C11H10F4N2S |
| Molecular Weight | 278.27 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 3-fluoro-4-[[2-(trifluoromethylsulfanyl)ethylamino]methyl]benzonitrile |
| SMILES | N#Cc1ccc(CNCCSC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C11H10F4N2S/c12-10-5-8(6-16)1-2-9(10)7-17-3-4-18-11(13,14)15/h1-2,5,17H,3-4,7H2 |
| InChIKey | WGOYVFYHABWWAN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|