C11H13ClF3NS — CID 106427292
N-[(4-chloro-2-methylphenyl)methyl]-2-(trifluoromethylsulfanyl)ethanamine (PubChem CID 106427292) has the molecular formula C11H13ClF3NS and a molecular weight of 283.75 g/mol. Its IUPAC name is N-[(4-chloro-2-methylphenyl)methyl]-2-(trifluoromethylsulfanyl)ethanamine.
| Compound Name | N-[(4-chloro-2-methylphenyl)methyl]-2-(trifluoromethylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 106427292 |
| Molecular Formula | C11H13ClF3NS |
| Molecular Weight | 283.75 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | N-[(4-chloro-2-methylphenyl)methyl]-2-(trifluoromethylsulfanyl)ethanamine |
| SMILES | Cc1cc(Cl)ccc1CNCCSC(F)(F)F |
| InChI | InChI=1S/C11H13ClF3NS/c1-8-6-10(12)3-2-9(8)7-16-4-5-17-11(13,14)15/h2-3,6,16H,4-5,7H2,1H3 |
| InChIKey | BMEKMNGQRAXZOE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.75 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|