C10H14F3NS2 — CID 103765794
N-[(2,5-dimethylthiophen-3-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine (PubChem CID 103765794) has the molecular formula C10H14F3NS2 and a molecular weight of 269.36 g/mol. Its IUPAC name is N-[(2,5-dimethylthiophen-3-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine.
| Compound Name | N-[(2,5-dimethylthiophen-3-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine |
|---|---|
| PubChem CID | 103765794 |
| Molecular Formula | C10H14F3NS2 |
| Molecular Weight | 269.36 g/mol |
| Exact Mass | 269.05 |
| IUPAC Name | N-[(2,5-dimethylthiophen-3-yl)methyl]-2-(trifluoromethylsulfanyl)ethanamine |
| SMILES | Cc1cc(CNCCSC(F)(F)F)c(C)s1 |
| InChI | InChI=1S/C10H14F3NS2/c1-7-5-9(8(2)16-7)6-14-3-4-15-10(11,12)13/h5,14H,3-4,6H2,1-2H3 |
| InChIKey | BMHVWVAUUQBHBD-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|