C11H19NOS — CID 64911526
4-[(2,5-dimethylthiophen-3-yl)methylamino]butan-2-ol (PubChem CID 64911526) has the molecular formula C11H19NOS and a molecular weight of 213.35 g/mol. Its IUPAC name is 4-[(2,5-dimethylthiophen-3-yl)methylamino]butan-2-ol.
| Compound Name | 4-[(2,5-dimethylthiophen-3-yl)methylamino]butan-2-ol |
|---|---|
| PubChem CID | 64911526 |
| Molecular Formula | C11H19NOS |
| Molecular Weight | 213.35 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 4-[(2,5-dimethylthiophen-3-yl)methylamino]butan-2-ol |
| SMILES | Cc1cc(CNCCC(C)O)c(C)s1 |
| InChI | InChI=1S/C11H19NOS/c1-8(13)4-5-12-7-11-6-9(2)14-10(11)3/h6,8,12-13H,4-5,7H2,1-3H3 |
| InChIKey | YQBDXKWULGDSPM-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|