C15H17Cl2NS — CID 63422918
2-(2,4-dichlorophenyl)-N-[(2,5-dimethylthiophen-3-yl)methyl]ethanamine (PubChem CID 63422918) has the molecular formula C15H17Cl2NS and a molecular weight of 314.28 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-[(2,5-dimethylthiophen-3-yl)methyl]ethanamine.
| Compound Name | 2-(2,4-dichlorophenyl)-N-[(2,5-dimethylthiophen-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 63422918 |
| Molecular Formula | C15H17Cl2NS |
| Molecular Weight | 314.28 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-[(2,5-dimethylthiophen-3-yl)methyl]ethanamine |
| SMILES | Cc1cc(CNCCc2ccc(Cl)cc2Cl)c(C)s1 |
| InChI | InChI=1S/C15H17Cl2NS/c1-10-7-13(11(2)19-10)9-18-6-5-12-3-4-14(16)8-15(12)17/h3-4,7-8,18H,5-6,9H2,1-2H3 |
| InChIKey | WLXNGGSCNQJPOY-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.28 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|