C10H11Cl2F2N — CID 60921887
N-[2-(2,4-dichlorophenyl)ethyl]-2,2-difluoroethanamine (PubChem CID 60921887) has the molecular formula C10H11Cl2F2N and a molecular weight of 254.11 g/mol. Its IUPAC name is N-[2-(2,4-dichlorophenyl)ethyl]-2,2-difluoroethanamine.
| Compound Name | N-[2-(2,4-dichlorophenyl)ethyl]-2,2-difluoroethanamine |
|---|---|
| PubChem CID | 60921887 |
| Molecular Formula | C10H11Cl2F2N |
| Molecular Weight | 254.11 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | N-[2-(2,4-dichlorophenyl)ethyl]-2,2-difluoroethanamine |
| SMILES | FC(F)CNCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C10H11Cl2F2N/c11-8-2-1-7(9(12)5-8)3-4-15-6-10(13)14/h1-2,5,10,15H,3-4,6H2 |
| InChIKey | SUCDSSVFUVHPBL-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.11 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|