C11H16Cl2N2O — CID 115120876
2-amino-3-[2-(2,4-dichlorophenyl)ethylamino]propan-1-ol (PubChem CID 115120876) has the molecular formula C11H16Cl2N2O and a molecular weight of 263.17 g/mol. Its IUPAC name is 2-amino-3-[2-(2,4-dichlorophenyl)ethylamino]propan-1-ol.
| Compound Name | 2-amino-3-[2-(2,4-dichlorophenyl)ethylamino]propan-1-ol |
|---|---|
| PubChem CID | 115120876 |
| Molecular Formula | C11H16Cl2N2O |
| Molecular Weight | 263.17 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 2-amino-3-[2-(2,4-dichlorophenyl)ethylamino]propan-1-ol |
| SMILES | NC(CO)CNCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C11H16Cl2N2O/c12-9-2-1-8(11(13)5-9)3-4-15-6-10(14)7-16/h1-2,5,10,15-16H,3-4,6-7,14H2 |
| InChIKey | OKTWEOZKSYYMRP-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.17 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|