C13H20Cl2N2O — CID 60897738
1-[2-(2,4-dichlorophenyl)ethylamino]-3-(dimethylamino)propan-2-ol (PubChem CID 60897738) has the molecular formula C13H20Cl2N2O and a molecular weight of 291.22 g/mol. Its IUPAC name is 1-[2-(2,4-dichlorophenyl)ethylamino]-3-(dimethylamino)propan-2-ol.
| Compound Name | 1-[2-(2,4-dichlorophenyl)ethylamino]-3-(dimethylamino)propan-2-ol |
|---|---|
| PubChem CID | 60897738 |
| Molecular Formula | C13H20Cl2N2O |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1-[2-(2,4-dichlorophenyl)ethylamino]-3-(dimethylamino)propan-2-ol |
| SMILES | CN(C)CC(O)CNCCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C13H20Cl2N2O/c1-17(2)9-12(18)8-16-6-5-10-3-4-11(14)7-13(10)15/h3-4,7,12,16,18H,5-6,8-9H2,1-2H3 |
| InChIKey | GIKLDCLJCNCMRT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|