C12H11Cl3N2S — CID 104878329
N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(2,4-dichlorophenyl)ethanamine (PubChem CID 104878329) has the molecular formula C12H11Cl3N2S and a molecular weight of 321.66 g/mol. Its IUPAC name is N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(2,4-dichlorophenyl)ethanamine.
| Compound Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(2,4-dichlorophenyl)ethanamine |
|---|---|
| PubChem CID | 104878329 |
| Molecular Formula | C12H11Cl3N2S |
| Molecular Weight | 321.66 g/mol |
| Exact Mass | 319.97 |
| IUPAC Name | N-[(5-chloro-1,3-thiazol-2-yl)methyl]-2-(2,4-dichlorophenyl)ethanamine |
| SMILES | Clc1ccc(CCNCc2ncc(Cl)s2)c(Cl)c1 |
| InChI | InChI=1S/C12H11Cl3N2S/c13-9-2-1-8(10(14)5-9)3-4-16-7-12-17-6-11(15)18-12/h1-2,5-6,16H,3-4,7H2 |
| InChIKey | IKSZVEVTFBJDHD-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.66 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|