C16H12Cl3N3S — CID 53273297
N-[[5-(2-chloro-3-pyridinyl)-1,3-thiazol-2-yl]methyl]-1-(2,4-dichlorophenyl)methanamine (PubChem CID 53273297) has the molecular formula C16H12Cl3N3S and a molecular weight of 384.72 g/mol. Its IUPAC name is N-[[5-(2-chloro-3-pyridinyl)-1,3-thiazol-2-yl]methyl]-1-(2,4-dichlorophenyl)methanamine.
| Compound Name | N-[[5-(2-chloro-3-pyridinyl)-1,3-thiazol-2-yl]methyl]-1-(2,4-dichlorophenyl)methanamine |
|---|---|
| PubChem CID | 53273297 |
| Molecular Formula | C16H12Cl3N3S |
| Molecular Weight | 384.72 g/mol |
| Exact Mass | 382.98 |
| IUPAC Name | N-[[5-(2-chloro-3-pyridinyl)-1,3-thiazol-2-yl]methyl]-1-(2,4-dichlorophenyl)methanamine |
| SMILES | Clc1ccc(CNCc2ncc(-c3cccnc3Cl)s2)c(Cl)c1 |
| InChI | InChI=1S/C16H12Cl3N3S/c17-11-4-3-10(13(18)6-11)7-20-9-15-22-8-14(23-15)12-2-1-5-21-16(12)19/h1-6,8,20H,7,9H2 |
| InChIKey | XFVFKUYSNMSRAW-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.72 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|