C17H15Cl2N3S — CID 53272585
2-(2,4-dichlorophenyl)-N-[(5-pyridin-3-yl-1,3-thiazol-2-yl)methyl]ethanamine (PubChem CID 53272585) has the molecular formula C17H15Cl2N3S and a molecular weight of 364.30 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-[(5-pyridin-3-yl-1,3-thiazol-2-yl)methyl]ethanamine.
| Compound Name | 2-(2,4-dichlorophenyl)-N-[(5-pyridin-3-yl-1,3-thiazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 53272585 |
| Molecular Formula | C17H15Cl2N3S |
| Molecular Weight | 364.30 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-[(5-pyridin-3-yl-1,3-thiazol-2-yl)methyl]ethanamine |
| SMILES | Clc1ccc(CCNCc2ncc(-c3cccnc3)s2)c(Cl)c1 |
| InChI | InChI=1S/C17H15Cl2N3S/c18-14-4-3-12(15(19)8-14)5-7-21-11-17-22-10-16(23-17)13-2-1-6-20-9-13/h1-4,6,8-10,21H,5,7,11H2 |
| InChIKey | XOFYWMUFSUTDEY-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.30 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|