C20H21Cl2N3S — CID 53272489
4-[2-[[2-(2,4-dichlorophenyl)ethylamino]methyl]-1,3-thiazol-5-yl]-N,N-dimethylaniline (PubChem CID 53272489) has the molecular formula C20H21Cl2N3S and a molecular weight of 406.38 g/mol. Its IUPAC name is 4-[2-[[2-(2,4-dichlorophenyl)ethylamino]methyl]-1,3-thiazol-5-yl]-N,N-dimethylaniline.
| Compound Name | 4-[2-[[2-(2,4-dichlorophenyl)ethylamino]methyl]-1,3-thiazol-5-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 53272489 |
| Molecular Formula | C20H21Cl2N3S |
| Molecular Weight | 406.38 g/mol |
| Exact Mass | 405.08 |
| IUPAC Name | 4-[2-[[2-(2,4-dichlorophenyl)ethylamino]methyl]-1,3-thiazol-5-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2cnc(CNCCc3ccc(Cl)cc3Cl)s2)cc1 |
| InChI | InChI=1S/C20H21Cl2N3S/c1-25(2)17-7-4-15(5-8-17)19-12-24-20(26-19)13-23-10-9-14-3-6-16(21)11-18(14)22/h3-8,11-12,23H,9-10,13H2,1-2H3 |
| InChIKey | ATYFTWHEQDFQEQ-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.38 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|