C19H18Cl2N2OS — CID 53272468
2-(2,4-dichlorophenyl)-N-[[5-(3-methoxyphenyl)-1,3-thiazol-2-yl]methyl]ethanamine (PubChem CID 53272468) has the molecular formula C19H18Cl2N2OS and a molecular weight of 393.34 g/mol. Its IUPAC name is 2-(2,4-dichlorophenyl)-N-[[5-(3-methoxyphenyl)-1,3-thiazol-2-yl]methyl]ethanamine.
| Compound Name | 2-(2,4-dichlorophenyl)-N-[[5-(3-methoxyphenyl)-1,3-thiazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 53272468 |
| Molecular Formula | C19H18Cl2N2OS |
| Molecular Weight | 393.34 g/mol |
| Exact Mass | 392.05 |
| IUPAC Name | 2-(2,4-dichlorophenyl)-N-[[5-(3-methoxyphenyl)-1,3-thiazol-2-yl]methyl]ethanamine |
| SMILES | COc1cccc(-c2cnc(CNCCc3ccc(Cl)cc3Cl)s2)c1 |
| InChI | InChI=1S/C19H18Cl2N2OS/c1-24-16-4-2-3-14(9-16)18-11-23-19(25-18)12-22-8-7-13-5-6-15(20)10-17(13)21/h2-6,9-11,22H,7-8,12H2,1H3 |
| InChIKey | KBWXXVNOLJKJLK-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.34 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|