C21H23ClN2O3S — CID 53273090
2-(2-chlorophenyl)-N-[[5-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]methyl]ethanamine (PubChem CID 53273090) has the molecular formula C21H23ClN2O3S and a molecular weight of 418.95 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[[5-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]methyl]ethanamine.
| Compound Name | 2-(2-chlorophenyl)-N-[[5-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 53273090 |
| Molecular Formula | C21H23ClN2O3S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[[5-(3,4,5-trimethoxyphenyl)-1,3-thiazol-2-yl]methyl]ethanamine |
| SMILES | COc1cc(-c2cnc(CNCCc3ccccc3Cl)s2)cc(OC)c1OC |
| InChI | InChI=1S/C21H23ClN2O3S/c1-25-17-10-15(11-18(26-2)21(17)27-3)19-12-24-20(28-19)13-23-9-8-14-6-4-5-7-16(14)22/h4-7,10-12,23H,8-9,13H2,1-3H3 |
| InChIKey | QSPCGFKPEDSYLE-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|