C17H17ClN2S2 — CID 53273303
2-(2-chlorophenyl)-N-[[5-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]methyl]ethanamine (PubChem CID 53273303) has the molecular formula C17H17ClN2S2 and a molecular weight of 348.92 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-N-[[5-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]methyl]ethanamine.
| Compound Name | 2-(2-chlorophenyl)-N-[[5-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 53273303 |
| Molecular Formula | C17H17ClN2S2 |
| Molecular Weight | 348.92 g/mol |
| Exact Mass | 348.05 |
| IUPAC Name | 2-(2-chlorophenyl)-N-[[5-(5-methylthiophen-2-yl)-1,3-thiazol-2-yl]methyl]ethanamine |
| SMILES | Cc1ccc(-c2cnc(CNCCc3ccccc3Cl)s2)s1 |
| InChI | InChI=1S/C17H17ClN2S2/c1-12-6-7-15(21-12)16-10-20-17(22-16)11-19-9-8-13-4-2-3-5-14(13)18/h2-7,10,19H,8-9,11H2,1H3 |
| InChIKey | YCJAWTGXOAPPDQ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.92 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|