C20H22ClN3S — CID 53272498
4-[2-[[2-(4-chlorophenyl)ethylamino]methyl]-1,3-thiazol-5-yl]-N,N-dimethylaniline (PubChem CID 53272498) has the molecular formula C20H22ClN3S and a molecular weight of 371.94 g/mol. Its IUPAC name is 4-[2-[[2-(4-chlorophenyl)ethylamino]methyl]-1,3-thiazol-5-yl]-N,N-dimethylaniline.
| Compound Name | 4-[2-[[2-(4-chlorophenyl)ethylamino]methyl]-1,3-thiazol-5-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 53272498 |
| Molecular Formula | C20H22ClN3S |
| Molecular Weight | 371.94 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 4-[2-[[2-(4-chlorophenyl)ethylamino]methyl]-1,3-thiazol-5-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2cnc(CNCCc3ccc(Cl)cc3)s2)cc1 |
| InChI | InChI=1S/C20H22ClN3S/c1-24(2)18-9-5-16(6-10-18)19-13-23-20(25-19)14-22-12-11-15-3-7-17(21)8-4-15/h3-10,13,22H,11-12,14H2,1-2H3 |
| InChIKey | YMNZDQGXFZJDJU-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.94 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|