C20H21FN2OS — CID 53272208
N-[[5-(4-ethoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-(4-fluorophenyl)ethanamine (PubChem CID 53272208) has the molecular formula C20H21FN2OS and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[[5-(4-ethoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-(4-fluorophenyl)ethanamine.
| Compound Name | N-[[5-(4-ethoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-(4-fluorophenyl)ethanamine |
|---|---|
| PubChem CID | 53272208 |
| Molecular Formula | C20H21FN2OS |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | N-[[5-(4-ethoxyphenyl)-1,3-thiazol-2-yl]methyl]-2-(4-fluorophenyl)ethanamine |
| SMILES | CCOc1ccc(-c2cnc(CNCCc3ccc(F)cc3)s2)cc1 |
| InChI | InChI=1S/C20H21FN2OS/c1-2-24-18-9-5-16(6-10-18)19-13-23-20(25-19)14-22-12-11-15-3-7-17(21)8-4-15/h3-10,13,22H,2,11-12,14H2,1H3 |
| InChIKey | QEVGNPZWDBMVKS-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|